CAS 76993-89-0 is the registry number for Chloro(1,10-phenanthroline)copper(I), 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Chlorocopper;1,10-phenanthroline (CAS 76993-89-0) is a chemical compound with the molecular formula C12H8ClCuN2 and a molecular weight of 279.20 g/mol. IUPAC name: chlorocopper;1,10-phenanthroline. InChIKey: ZPNKUACRPIJETF-UHFFFAOYSA-M.
| Molecular formula | C12H8ClCuN2 |
|---|---|
| Molecular weight | 279.20 g/mol |
| IUPAC name | chlorocopper;1,10-phenanthroline |
| InChIKey | ZPNKUACRPIJETF-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.Cl[Cu] |
Computed by PubChem (NCBI)