CAS 769930-41-8 is the registry number for N-[(4-Chlorophenyl)sulfonyl]-n-(3,4-dimethylphenyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)acetic acid (CAS 769930-41-8) is a chemical compound with the molecular formula C16H16ClNO4S and a molecular weight of 353.8 g/mol. IUPAC name: 2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)acetic acid. InChIKey: XPJURTVWRVEETJ-UHFFFAOYSA-N.
| Molecular formula | C16H16ClNO4S |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)acetic acid |
| InChIKey | XPJURTVWRVEETJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N(CC(=O)O)S(=O)(=O)C2=CC=C(C=C2)Cl)C |
Computed by PubChem (NCBI)