Products 77-89-4
CAS 77-89-4 appears in our catalog under these names: O-Acetylcitric acid triethyl ester, 97%, Citric acid, acetyl triethyl ester, Triethyl O-Acetylcitrate, Triethyl O-Acetylcitrate, >97.0%(GC), Acetyltriethyl citrate 97%. Offered by: Combi-blocks, Dr. Ehrenstorfer, TRC, TCI, Ambeed. Available pack sizes: 5g, 25g, 100g, 1kg, 500g, 1ml, 10g, 50g.
Triethyl 2-acetyloxypropane-1,2,3-tricarboxylate (CAS 77-89-4) is a chemical compound with the molecular formula C14H22O8 and a molecular weight of 318.32 g/mol. IUPAC name: triethyl 2-acetyloxypropane-1,2,3-tricarboxylate. InChIKey: WEAPVABOECTMGR-UHFFFAOYSA-N.
| Molecular formula | C14H22O8 |
|---|---|
| Molecular weight | 318.32 g/mol |
| IUPAC name | triethyl 2-acetyloxypropane-1,2,3-tricarboxylate |
| InChIKey | WEAPVABOECTMGR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Acetyl triethyl citrate, Acetyltriethyl citrate, 1,2,3-Propanetricarboxylic acid, 2-(acetyloxy)-, triethyl ester, 2-(Acetyloxy)-1,2,3-propanetricarboxylic acid, triethyl ester, Triethyl 2-acetoxypropane-1,2,3-tricarboxylate, Triethyl O-acetylcitrate, ATEC, Citroflex A 2, Triethyl 2-acetylcitrate, Triethyl acetylcitrate