Products 770-96-7
CAS 770-96-7 is the registry number for Indene-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 100 mg, 10 mg, 50 mg.
1,1,3-trideuterioindene (CAS 770-96-7) is a chemical compound with the molecular formula C9H8 and a molecular weight of 119.18 g/mol. IUPAC name: 1,1,3-trideuterioindene. InChIKey: YBYIRNPNPLQARY-XOFOOSGASA-N.
| Molecular formula | C9H8 |
|---|---|
| Molecular weight | 119.18 g/mol |
| IUPAC name | 1,1,3-trideuterioindene |
| InChIKey | YBYIRNPNPLQARY-XOFOOSGASA-N |
| SMILES | [2H]C1=CC(C2=CC=CC=C12)([2H])[2H] |
Computed by PubChem (NCBI)