CAS 77062-84-1 appears in our catalog under these names: Methyl 2-hydroxy-2-(m-tolyl)acetate, 97%, Methyl 2-hydroxy-2-(3-methylphenyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
Methyl 2-hydroxy-2-(3-methylphenyl)acetate (CAS 77062-84-1) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: methyl 2-hydroxy-2-(3-methylphenyl)acetate. InChIKey: FMSDRGSMDPMNLQ-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | methyl 2-hydroxy-2-(3-methylphenyl)acetate |
| InChIKey | FMSDRGSMDPMNLQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(C(=O)OC)O |
Computed by PubChem (NCBI)