Products 77063-20-8

CAS 77063-20-8 is the registry number for Chlorambucil Isopropyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Propan-2-yl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate (CAS 77063-20-8) is a chemical compound with the molecular formula C17H25Cl2NO2 and a molecular weight of 346.3 g/mol. IUPAC name: propan-2-yl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate. InChIKey: DITVVZADYIYAAS-UHFFFAOYSA-N.

Identity
Molecular formulaC17H25Cl2NO2
Molecular weight346.3 g/mol
IUPAC namepropan-2-yl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate
InChIKeyDITVVZADYIYAAS-UHFFFAOYSA-N
SMILESCC(C)OC(=O)CCCC1=CC=C(C=C1)N(CCCl)CCCl

Computed by PubChem (NCBI)