Products 770735-58-5
CAS 770735-58-5 appears in our catalog under these names: 1,3-Phenylenediamine-d4, >95% (HPLC), 1,3-Benzenediamine-d8, 97 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 10mg, 0,5g, 0,25g.
1-N,1-N,3-N,3-N,2,4,5,6-octadeuteriobenzene-1,3-diamine (CAS 770735-58-5) is a chemical compound with the molecular formula C6H8N2 and a molecular weight of 116.19 g/mol. IUPAC name: 1-N,1-N,3-N,3-N,2,4,5,6-octadeuteriobenzene-1,3-diamine. InChIKey: WZCQRUWWHSTZEM-GCJHLHDMSA-N.
| Molecular formula | C6H8N2 |
|---|---|
| Molecular weight | 116.19 g/mol |
| IUPAC name | 1-N,1-N,3-N,3-N,2,4,5,6-octadeuteriobenzene-1,3-diamine |
| InChIKey | WZCQRUWWHSTZEM-GCJHLHDMSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])N([2H])[2H])[2H])N([2H])[2H])[2H] |
Computed by PubChem (NCBI)