CAS 77117-48-7 is the registry number for (Perfluoro-n-octyl)ethane, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane (CAS 77117-48-7) is a chemical compound with the molecular formula C10H5F17 and a molecular weight of 448.12 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane. InChIKey: JNAIMEWMJYVGEW-UHFFFAOYSA-N.
| Molecular formula | C10H5F17 |
|---|---|
| Molecular weight | 448.12 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorodecane |
| InChIKey | JNAIMEWMJYVGEW-UHFFFAOYSA-N |
| SMILES | CCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)