Products 7712-52-9

CAS 7712-52-9 is the registry number for Pinaverium Bromide Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[2-[2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethoxy]ethyl]morpholine (CAS 7712-52-9) is a chemical compound with the molecular formula C17H29NO2 and a molecular weight of 279.4 g/mol. IUPAC name: 4-[2-[2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethoxy]ethyl]morpholine. InChIKey: HTGHTZQJMLRTKH-UHFFFAOYSA-N.

Identity
Molecular formulaC17H29NO2
Molecular weight279.4 g/mol
IUPAC name4-[2-[2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethoxy]ethyl]morpholine
InChIKeyHTGHTZQJMLRTKH-UHFFFAOYSA-N
SMILESCC1(C2CC=C(C1C2)CCOCCN3CCOCC3)C

Computed by PubChem (NCBI)