CAS 77122-21-5 appears in our catalog under these names: (2R)-2,3-Dihydro-1H-indol-2-ylmethanol, 95%, (R)-Indolin-2-ylmethanol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 100mg, 5g.
[(2R)-2,3-dihydro-1H-indol-2-yl]methanol (CAS 77122-21-5) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: [(2R)-2,3-dihydro-1H-indol-2-yl]methanol. InChIKey: GRPOFAKYHPAXNP-MRVPVSSYSA-N.
| Molecular formula | C9H11NO |
|---|---|
| Molecular weight | 149.19 g/mol |
| IUPAC name | [(2R)-2,3-dihydro-1H-indol-2-yl]methanol |
| InChIKey | GRPOFAKYHPAXNP-MRVPVSSYSA-N |
| SMILES | C1[C@@H](NC2=CC=CC=C21)CO |
Computed by PubChem (NCBI)