Products 771483-74-0
CAS 771483-74-0 appears in our catalog under these names: 4-Fluoro-2-(1-methyl-1h-pyrazol-5-yl)phenol, 95%, 4-Fluoro-2-(1-methyl-1H-pyrazol-5-yl)phenol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
4-fluoro-2-(2-methylpyrazol-3-yl)phenol (CAS 771483-74-0) is a chemical compound with the molecular formula C10H9FN2O and a molecular weight of 192.19 g/mol. IUPAC name: 4-fluoro-2-(2-methylpyrazol-3-yl)phenol. InChIKey: DLZHGRRGHBXHCO-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2O |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | 4-fluoro-2-(2-methylpyrazol-3-yl)phenol |
| InChIKey | DLZHGRRGHBXHCO-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2=C(C=CC(=C2)F)O |
Computed by PubChem (NCBI)