CAS 543713-33-3 is the registry number for (3-(2-Fluorophenyl)isoxazol-5-yl)methanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methanamine (CAS 543713-33-3) is a chemical compound with the molecular formula C10H9FN2O and a molecular weight of 192.19 g/mol. IUPAC name: [3-(2-fluorophenyl)-1,2-oxazol-5-yl]methanamine. InChIKey: LTQAXBKYVMMKCG-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2O |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | [3-(2-fluorophenyl)-1,2-oxazol-5-yl]methanamine |
| InChIKey | LTQAXBKYVMMKCG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=C2)CN)F |
Computed by PubChem (NCBI)