CAS 771572-16-8 is the registry number for (4-[3,5-Bis(trifluoromethyl)phenoxy]phenyl)methylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methanamine (CAS 771572-16-8) is a chemical compound with the molecular formula C15H11F6NO and a molecular weight of 335.24 g/mol. IUPAC name: [4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methanamine. InChIKey: LEMJNIFCYZYXCG-UHFFFAOYSA-N.
| Molecular formula | C15H11F6NO |
|---|---|
| Molecular weight | 335.24 g/mol |
| IUPAC name | [4-[3,5-bis(trifluoromethyl)phenoxy]phenyl]methanamine |
| InChIKey | LEMJNIFCYZYXCG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)OC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)