CAS 77167-46-5 is the registry number for (2S)-2-Amino-n,n,4-trimethylpentanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2S)-2-amino-N,N,4-trimethylpentanamide (CAS 77167-46-5) is a chemical compound with the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. IUPAC name: (2S)-2-amino-N,N,4-trimethylpentanamide. InChIKey: VINQQWZFGIKZAZ-ZETCQYMHSA-N.
| Molecular formula | C8H18N2O |
|---|---|
| Molecular weight | 158.24 g/mol |
| IUPAC name | (2S)-2-amino-N,N,4-trimethylpentanamide |
| InChIKey | VINQQWZFGIKZAZ-ZETCQYMHSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N(C)C)N |
Computed by PubChem (NCBI)