CAS 77167-53-4 is the registry number for Leu–Leu–OBzl. Offered by: GLPBio. Available pack sizes: 1g.
Benzyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoate (CAS 77167-53-4) is a chemical compound with the molecular formula C19H30N2O3 and a molecular weight of 334.5 g/mol. IUPAC name: benzyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoate. InChIKey: WBNRJPDMGKHHSP-IRXDYDNUSA-N.
| Molecular formula | C19H30N2O3 |
|---|---|
| Molecular weight | 334.5 g/mol |
| IUPAC name | benzyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoate |
| InChIKey | WBNRJPDMGKHHSP-IRXDYDNUSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)OCC1=CC=CC=C1)N |
Computed by PubChem (NCBI)