CAS 77167-93-2 is the registry number for L 640035. Offered by: MedChemExpress. Available pack sizes: Get quote.
(11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol (CAS 77167-93-2) is a chemical compound with the molecular formula C15H12O3S and a molecular weight of 272.3 g/mol. IUPAC name: (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol. InChIKey: NYFDVYBQHBRTNS-UHFFFAOYSA-N.
| Molecular formula | C15H12O3S |
|---|---|
| Molecular weight | 272.3 g/mol |
| IUPAC name | (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol |
| InChIKey | NYFDVYBQHBRTNS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C(S2(=O)=O)C=C(C=C3)CO |
Computed by PubChem (NCBI)