CAS 77186-48-2 appears in our catalog under these names: 2-(2-Chlorophenyl)-3-oxobutanenitrile, 2-(2-Chlorophenyl)-3-oxobutanenitrile, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 10g.
2-(2-chlorophenyl)-3-oxobutanenitrile (CAS 77186-48-2) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 2-(2-chlorophenyl)-3-oxobutanenitrile. InChIKey: LDPBVMZXVUMUME-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-3-oxobutanenitrile |
| InChIKey | LDPBVMZXVUMUME-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C#N)C1=CC=CC=C1Cl |
Computed by PubChem (NCBI)