CAS 7720-19-6 appears in our catalog under these names: 3-Hydroxybenzoic acid sodium salt, 96%, 3–Hydroxybenzoic acid (sodium), Sodium 3-Hydroxybenzoate, >99.0%(T), 3-Hydroxybenzoic acid sodium salt, 97%, 97%, Sodium 3-hydroxybenzoate, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g.
Sodium 3-hydroxybenzoate (CAS 7720-19-6) is a chemical compound with the molecular formula C7H5NaO3 and a molecular weight of 160.10 g/mol. IUPAC name: sodium 3-hydroxybenzoate. InChIKey: UZLYOWSQVRAOBL-UHFFFAOYSA-M.
| Molecular formula | C7H5NaO3 |
|---|---|
| Molecular weight | 160.10 g/mol |
| IUPAC name | sodium 3-hydroxybenzoate |
| InChIKey | UZLYOWSQVRAOBL-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC(=C1)O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)