CAS 773-63-7 appears in our catalog under these names: 2,3,3–Trimethyl–3H–indol–5–amine, 2,3,3-Trimethyl-3H-indol-5-amine 95%, 2,3,3-Trimethyl-3H-indol-5-amine, 95%, 95%, 2,3,3-Trimethyl-3H-indol-5-amine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
2,3,3-trimethylindol-5-amine (CAS 773-63-7) is a chemical compound with the molecular formula C11H14N2 and a molecular weight of 174.24 g/mol. IUPAC name: 2,3,3-trimethylindol-5-amine. InChIKey: CPPYFOCHFCYAQQ-UHFFFAOYSA-N.
| Molecular formula | C11H14N2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 2,3,3-trimethylindol-5-amine |
| InChIKey | CPPYFOCHFCYAQQ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)C)C=C(C=C2)N |
Computed by PubChem (NCBI)