CAS 77302-11-5 is the registry number for (2R,3S)-3-Hydroxy-2-methylpentanoic Acid. Offered by: TRC. Available pack sizes: 1g.
(2R,3S)-3-hydroxy-2-methylpentanoic acid (CAS 77302-11-5) is a chemical compound with the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. IUPAC name: (2R,3S)-3-hydroxy-2-methylpentanoic acid. InChIKey: NVIHALDXJWGLFD-UHNVWZDZSA-N.
| Molecular formula | C6H12O3 |
|---|---|
| Molecular weight | 132.16 g/mol |
| IUPAC name | (2R,3S)-3-hydroxy-2-methylpentanoic acid |
| InChIKey | NVIHALDXJWGLFD-UHNVWZDZSA-N |
| SMILES | CC[C@@H]([C@@H](C)C(=O)O)O |
Computed by PubChem (NCBI)