CAS 773128-24-8 is the registry number for N-Boc-3-iodo-L-alanine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 773128-24-8) is a chemical compound with the molecular formula C8H14INO4 and a molecular weight of 315.11 g/mol. IUPAC name: (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VPJPNDRAPYPUPA-YFKPBYRVSA-N.
| Molecular formula | C8H14INO4 |
|---|---|
| Molecular weight | 315.11 g/mol |
| IUPAC name | (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VPJPNDRAPYPUPA-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CI)C(=O)O |
Computed by PubChem (NCBI)