CAS 773131-96-7 appears in our catalog under these names: 3-(2-Amino-3-pyridyl)acrylic acid, 95%, 3-(2-Amino-3-pyridyl)acrylic acid, 95+%, 3-(2-AMINO-3-PYRIDYL)ACRYLIC ACID, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
3-(2-amino-3-pyridinyl)prop-2-enoic acid (CAS 773131-96-7) is a chemical compound with the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. IUPAC name: 3-(2-amino-3-pyridinyl)prop-2-enoic acid. InChIKey: HKUVFKTUMTYXQT-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 3-(2-amino-3-pyridinyl)prop-2-enoic acid |
| InChIKey | HKUVFKTUMTYXQT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N)C=CC(=O)O |
Computed by PubChem (NCBI)