Products 773137-11-4
CAS 773137-11-4 is the registry number for Ethyl 2,6-dichloro-3-nitro-benzoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
Ethyl 2,6-dichloro-3-nitrobenzoate (CAS 773137-11-4) is a chemical compound with the molecular formula C9H7Cl2NO4 and a molecular weight of 264.06 g/mol. IUPAC name: ethyl 2,6-dichloro-3-nitrobenzoate. InChIKey: SHBDHFAADUABST-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO4 |
|---|---|
| Molecular weight | 264.06 g/mol |
| IUPAC name | ethyl 2,6-dichloro-3-nitrobenzoate |
| InChIKey | SHBDHFAADUABST-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)