CAS 77332-77-5 is the registry number for 3-Fluoro-4-(trimethylsilyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
(3-fluoro-4-pyridinyl)-trimethylsilane (CAS 77332-77-5) is a chemical compound with the molecular formula C8H12FNSi and a molecular weight of 169.27 g/mol. IUPAC name: (3-fluoro-4-pyridinyl)-trimethylsilane. InChIKey: XNXHCROGITZUAY-UHFFFAOYSA-N.
| Molecular formula | C8H12FNSi |
|---|---|
| Molecular weight | 169.27 g/mol |
| IUPAC name | (3-fluoro-4-pyridinyl)-trimethylsilane |
| InChIKey | XNXHCROGITZUAY-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=NC=C1)F |
Computed by PubChem (NCBI)