CAS 77341-63-0 is the registry number for (2R,3S)-3-Hydroxy-2,4-dimethylpentanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2R,3S)-3-hydroxy-2,4-dimethylpentanoic acid (CAS 77341-63-0) is a chemical compound with the molecular formula C7H14O3 and a molecular weight of 146.18 g/mol. IUPAC name: (2R,3S)-3-hydroxy-2,4-dimethylpentanoic acid. InChIKey: ICRIJRMABYUYBG-RITPCOANSA-N.
| Molecular formula | C7H14O3 |
|---|---|
| Molecular weight | 146.18 g/mol |
| IUPAC name | (2R,3S)-3-hydroxy-2,4-dimethylpentanoic acid |
| InChIKey | ICRIJRMABYUYBG-RITPCOANSA-N |
| SMILES | C[C@H]([C@H](C(C)C)O)C(=O)O |
Computed by PubChem (NCBI)