CAS 77385-90-1 appears in our catalog under these names: N,N-Dibenzylglycine Ethyl Ester, Ethyl 2–(dibenzylamino)acetate, N,N-Dibenzylglycine Ethyl Ester, >98.0%(GC)(N), Ethyl 2-(Dibenzylamino)acetate, 97%, 97%, Ethyl 2-(dibenzylamino)acetate, 95%. Offered by: TRC, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 100g, 25g, 5g, 500g, 1g.
Ethyl 2-(dibenzylamino)acetate (CAS 77385-90-1) is a chemical compound with the molecular formula C18H21NO2 and a molecular weight of 283.4 g/mol. IUPAC name: ethyl 2-(dibenzylamino)acetate. InChIKey: AFMDCFOWHWNQBP-UHFFFAOYSA-N.
| Molecular formula | C18H21NO2 |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | ethyl 2-(dibenzylamino)acetate |
| InChIKey | AFMDCFOWHWNQBP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN(CC1=CC=CC=C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)