CAS 773865-50-2 is the registry number for 4-(4,5-Dichloro-6-oxo-1(6H)-pyridazinyl)-N-(phenylmethyl)benzamide. Offered by: TRC. Available pack sizes: 1g.
N-benzyl-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzamide (CAS 773865-50-2) is a chemical compound with the molecular formula C18H13Cl2N3O2 and a molecular weight of 374.2 g/mol. IUPAC name: N-benzyl-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzamide. InChIKey: JZFYYRKAFNWMJD-UHFFFAOYSA-N.
| Molecular formula | C18H13Cl2N3O2 |
|---|---|
| Molecular weight | 374.2 g/mol |
| IUPAC name | N-benzyl-4-(4,5-dichloro-6-oxopyridazin-1-yl)benzamide |
| InChIKey | JZFYYRKAFNWMJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CC=C(C=C2)N3C(=O)C(=C(C=N3)Cl)Cl |
Computed by PubChem (NCBI)