CAS 773869-56-0 appears in our catalog under these names: 5-Chloro-2-hydroxyisophthalic acid, 95+%, 5-Chloro-2-hydroxybenzene-1,3-dicarboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-chloro-2-hydroxybenzene-1,3-dicarboxylic acid (CAS 773869-56-0) is a chemical compound with the molecular formula C8H5ClO5 and a molecular weight of 216.57 g/mol. IUPAC name: 5-chloro-2-hydroxybenzene-1,3-dicarboxylic acid. InChIKey: DCLNMNSLIOUGNJ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO5 |
|---|---|
| Molecular weight | 216.57 g/mol |
| IUPAC name | 5-chloro-2-hydroxybenzene-1,3-dicarboxylic acid |
| InChIKey | DCLNMNSLIOUGNJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)O)C(=O)O)Cl |
Computed by PubChem (NCBI)