Products 773869-56-0

CAS 773869-56-0 appears in our catalog under these names: 5-Chloro-2-hydroxyisophthalic acid, 95+%, 5-Chloro-2-hydroxybenzene-1,3-dicarboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-chloro-2-hydroxybenzene-1,3-dicarboxylic acid (CAS 773869-56-0) is a chemical compound with the molecular formula C8H5ClO5 and a molecular weight of 216.57 g/mol. IUPAC name: 5-chloro-2-hydroxybenzene-1,3-dicarboxylic acid. InChIKey: DCLNMNSLIOUGNJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClO5
Molecular weight216.57 g/mol
IUPAC name5-chloro-2-hydroxybenzene-1,3-dicarboxylic acid
InChIKeyDCLNMNSLIOUGNJ-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)O)C(=O)O)Cl

Computed by PubChem (NCBI)