CAS 77400-30-7 is the registry number for 4,5-Dinitrocatechol, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
4,5-dinitrobenzene-1,2-diol (CAS 77400-30-7) is a chemical compound with the molecular formula C6H4N2O6 and a molecular weight of 200.11 g/mol. IUPAC name: 4,5-dinitrobenzene-1,2-diol. InChIKey: ZUWVFOJZGCLEKC-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O6 |
|---|---|
| Molecular weight | 200.11 g/mol |
| IUPAC name | 4,5-dinitrobenzene-1,2-diol |
| InChIKey | ZUWVFOJZGCLEKC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1O)O)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)