Products 77408-77-6
CAS 77408-77-6 is the registry number for 5-Amino-1,3-benzoxazol-2(3H)-one hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg.
5-amino-3H-1,3-benzoxazol-2-one;hydrochloride (CAS 77408-77-6) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: 5-amino-3H-1,3-benzoxazol-2-one;hydrochloride. InChIKey: VYFLYXUVUPVKPR-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 5-amino-3H-1,3-benzoxazol-2-one;hydrochloride |
| InChIKey | VYFLYXUVUPVKPR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)NC(=O)O2.Cl |
Computed by PubChem (NCBI)