CAS 774160-67-7 is the registry number for N-(Phenylpropyl)-2,4-dichloroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,4-dichloro-N-(3-phenylpropyl)aniline (CAS 774160-67-7) is a chemical compound with the molecular formula C15H15Cl2N and a molecular weight of 280.2 g/mol. IUPAC name: 2,4-dichloro-N-(3-phenylpropyl)aniline. InChIKey: JBJNAQTZCRRWCR-UHFFFAOYSA-N.
| Molecular formula | C15H15Cl2N |
|---|---|
| Molecular weight | 280.2 g/mol |
| IUPAC name | 2,4-dichloro-N-(3-phenylpropyl)aniline |
| InChIKey | JBJNAQTZCRRWCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCNC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)