Products 774173-70-5
CAS 774173-70-5 is the registry number for Etidronic Acid-d3 Sodium Salt. Offered by: TRC. Available pack sizes: 50mg, 5mg.
(2,2,2-trideuterio-1-hydroxy-1-phosphonoethyl)phosphonic acid (CAS 774173-70-5) is a chemical compound with the molecular formula C2H8O7P2 and a molecular weight of 209.05 g/mol. IUPAC name: (2,2,2-trideuterio-1-hydroxy-1-phosphonoethyl)phosphonic acid. InChIKey: DBVJJBKOTRCVKF-FIBGUPNXSA-N.
| Molecular formula | C2H8O7P2 |
|---|---|
| Molecular weight | 209.05 g/mol |
| IUPAC name | (2,2,2-trideuterio-1-hydroxy-1-phosphonoethyl)phosphonic acid |
| InChIKey | DBVJJBKOTRCVKF-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(O)(P(=O)(O)O)P(=O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
Etidronic Acid-d3, Etidronic Acid-d3 Sodium Salt, (2,2,2-trideuterio-1-hydroxy-1-phosphonoethyl)phosphonic acid, Disodium Etidronate-d3 (methyl-d3), [1-hydroxy-1-phosphono(2,2,2-?H?)ethyl]phosphonic acid, Disodium Etidrote-d3(methyl-d3), [1-Hydroxy(~2~H_3_)ethane-1,1-diyl]bis(phosphonic acid)