CAS 77422-70-9 appears in our catalog under these names: Azidomethyl Phenyl Sulfide, AZIDOMETHYL PHENYL SULFIDE, 95%, Azidomethyl Phenyl Sulfide, 95%,RG, 95%,RG, (diazyn-1-ium-1-yl)[(phenylsulfanyl)methyl]azanide, ≥95%. Offered by: GLPBio, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 250mg, 1G, 100mg.
Azidomethylsulfanylbenzene (CAS 77422-70-9) is a chemical compound with the molecular formula C7H7N3S and a molecular weight of 165.22 g/mol. IUPAC name: azidomethylsulfanylbenzene. InChIKey: KIQGRMGPIMCXSC-UHFFFAOYSA-N.
| Molecular formula | C7H7N3S |
|---|---|
| Molecular weight | 165.22 g/mol |
| IUPAC name | azidomethylsulfanylbenzene |
| InChIKey | KIQGRMGPIMCXSC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SCN=[N+]=[N-] |
Computed by PubChem (NCBI)