CAS 77435-46-2 appears in our catalog under these names: Sulfanilamide-d4, Sulfanilamide-d4 (ring-d4), 98 atom % D, min 98% Chemical Purity, Sulfanilamide-d4 (ring-d4), >95% (HPLC), Sulfanilamide–d4, Sulfanilamide-d4, 99.99%. Offered by: Chemat Brand, CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 0,01g, 0,005g, 10mg, 5mg, 1mg, 5 mg, 1 mg.
4-amino-2,3,5,6-tetradeuteriobenzenesulfonamide (CAS 77435-46-2) is a chemical compound with the molecular formula C6H8N2O2S and a molecular weight of 176.23 g/mol. IUPAC name: 4-amino-2,3,5,6-tetradeuteriobenzenesulfonamide. InChIKey: FDDDEECHVMSUSB-RHQRLBAQSA-N.
| Molecular formula | C6H8N2O2S |
|---|---|
| Molecular weight | 176.23 g/mol |
| IUPAC name | 4-amino-2,3,5,6-tetradeuteriobenzenesulfonamide |
| InChIKey | FDDDEECHVMSUSB-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)N)[2H] |
Computed by PubChem (NCBI)