CAS 77451-51-5 appears in our catalog under these names: 1-(P-Toluenesulfonyl)-3-nitro-1,2,4-triazole, 98%, 3-Nitro-1-tosyl-1H-1,2,4-triazole, 98%, 1–(p–Toluenesulfonyl)–3–nitro–1,2,4–triazole, 3-Nitro-1-tosyl-1H-1,2,4-triazole, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 10g.
1-(4-methylphenyl)sulfonyl-3-nitro-1,2,4-triazole (CAS 77451-51-5) is a chemical compound with the molecular formula C9H8N4O4S and a molecular weight of 268.25 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-3-nitro-1,2,4-triazole. InChIKey: ZQMJAWSQRGYFBM-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O4S |
|---|---|
| Molecular weight | 268.25 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-3-nitro-1,2,4-triazole |
| InChIKey | ZQMJAWSQRGYFBM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=NC(=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)