CAS 774597-13-6 appears in our catalog under these names: (E)-2-(3-(Trimethylsilyl)allyl)-1,3,6,2-dioxazaborocane, 95%, 95%, (E)-2-(3-(Trimethylsilyl)allyl)-1,3,6,2-dioxazaborocane, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
[(E)-3-(1,3,6,2-dioxazaborocan-2-yl)prop-1-enyl]-trimethylsilane (CAS 774597-13-6) is a chemical compound with the molecular formula C10H22BNO2Si and a molecular weight of 227.19 g/mol. IUPAC name: [(E)-3-(1,3,6,2-dioxazaborocan-2-yl)prop-1-enyl]-trimethylsilane. InChIKey: OIZDHLXQPPZNRT-ONNFQVAWSA-N.
| Molecular formula | C10H22BNO2Si |
|---|---|
| Molecular weight | 227.19 g/mol |
| IUPAC name | [(E)-3-(1,3,6,2-dioxazaborocan-2-yl)prop-1-enyl]-trimethylsilane |
| InChIKey | OIZDHLXQPPZNRT-ONNFQVAWSA-N |
| SMILES | B1(OCCNCCO1)C/C=C/[Si](C)(C)C |
Computed by PubChem (NCBI)