CAS 77482-44-1 appears in our catalog under these names: GEMSA, 2–Guanidinoethylmercaptosuccinic Acid, 2-Guanidinoethylmercaptosuccinic acid, 2-Guanidinoethylmercaptosuccinic Acid, ≥97%, ≥97%, 2-Guanidinoethylmercaptosucc 1PC X 5MG. Offered by: TargetMol, GLPBio, Biosynth, Chemat, Sigma-Aldrich. Available pack sizes: 5mg, 1mg, 2mg, 25mg, 10mg, 5 mg.
(2S)-2-[2-(diaminomethylideneamino)ethylsulfanyl]butanedioic acid (CAS 77482-44-1) is a chemical compound with the molecular formula C7H13N3O4S and a molecular weight of 235.26 g/mol. IUPAC name: (2S)-2-[2-(diaminomethylideneamino)ethylsulfanyl]butanedioic acid. InChIKey: VKVCLXDFOQQABP-BYPYZUCNSA-N.
| Molecular formula | C7H13N3O4S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | (2S)-2-[2-(diaminomethylideneamino)ethylsulfanyl]butanedioic acid |
| InChIKey | VKVCLXDFOQQABP-BYPYZUCNSA-N |
| SMILES | C(CS[C@@H](CC(=O)O)C(=O)O)N=C(N)N |
Computed by PubChem (NCBI)