Products 77482-44-1

CAS 77482-44-1 appears in our catalog under these names: GEMSA, 2–Guanidinoethylmercaptosuccinic Acid, 2-Guanidinoethylmercaptosuccinic acid, 2-Guanidinoethylmercaptosuccinic Acid, ≥97%, ≥97%, 2-Guanidinoethylmercaptosucc 1PC X 5MG. Offered by: TargetMol, GLPBio, Biosynth, Chemat, Sigma-Aldrich. Available pack sizes: 5mg, 1mg, 2mg, 25mg, 10mg, 5 mg.

Structural formula: {0} (CAS {1})

(2S)-2-[2-(diaminomethylideneamino)ethylsulfanyl]butanedioic acid (CAS 77482-44-1) is a chemical compound with the molecular formula C7H13N3O4S and a molecular weight of 235.26 g/mol. IUPAC name: (2S)-2-[2-(diaminomethylideneamino)ethylsulfanyl]butanedioic acid. InChIKey: VKVCLXDFOQQABP-BYPYZUCNSA-N.

Identity
Molecular formulaC7H13N3O4S
Molecular weight235.26 g/mol
IUPAC name(2S)-2-[2-(diaminomethylideneamino)ethylsulfanyl]butanedioic acid
InChIKeyVKVCLXDFOQQABP-BYPYZUCNSA-N
SMILESC(CS[C@@H](CC(=O)O)C(=O)O)N=C(N)N

Computed by PubChem (NCBI)