CAS 77496-07-2 is the registry number for [1,1':4',1'':4'',1''':4''',1'''':4'''',1'''''-Sexiphenyl]-4,4'''''-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-[4-[4-[4-(4-aminophenyl)phenyl]phenyl]phenyl]phenyl]aniline (CAS 77496-07-2) is a chemical compound with the molecular formula C36H28N2 and a molecular weight of 488.6 g/mol. IUPAC name: 4-[4-[4-[4-[4-(4-aminophenyl)phenyl]phenyl]phenyl]phenyl]aniline. InChIKey: DUYKCJMMDVDAOR-UHFFFAOYSA-N.
| Molecular formula | C36H28N2 |
|---|---|
| Molecular weight | 488.6 g/mol |
| IUPAC name | 4-[4-[4-[4-[4-(4-aminophenyl)phenyl]phenyl]phenyl]phenyl]aniline |
| InChIKey | DUYKCJMMDVDAOR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)N)C5=CC=C(C=C5)C6=CC=C(C=C6)N |
Computed by PubChem (NCBI)