CAS 119546-69-9 is the registry number for N4,N4'-Di([1,1'-biphenyl]-4-yl)-[1,1'-biphenyl]-4,4'-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-phenyl-N-[4-[4-(4-phenylanilino)phenyl]phenyl]aniline (CAS 119546-69-9) is a chemical compound with the molecular formula C36H28N2 and a molecular weight of 488.6 g/mol. IUPAC name: 4-phenyl-N-[4-[4-(4-phenylanilino)phenyl]phenyl]aniline. InChIKey: WMZSBQFUEJWRKJ-UHFFFAOYSA-N.
| Molecular formula | C36H28N2 |
|---|---|
| Molecular weight | 488.6 g/mol |
| IUPAC name | 4-phenyl-N-[4-[4-(4-phenylanilino)phenyl]phenyl]aniline |
| InChIKey | WMZSBQFUEJWRKJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)C4=CC=C(C=C4)NC5=CC=C(C=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)