CAS 77504-74-6 appears in our catalog under these names: Ethyl 3-oxobutanoate-2,4-13C2, 99% 99%atom%13C, ETHYL ACETOACETATE-2,4-13C2, 99 ATOM % &. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 500MG.
Ethyl 3-oxo(2,4-13C2)butanoate (CAS 77504-74-6) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 132.13 g/mol. IUPAC name: ethyl 3-oxo(2,4-13C2)butanoate. InChIKey: XYIBRDXRRQCHLP-NDLBAUGKSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 132.13 g/mol |
| IUPAC name | ethyl 3-oxo(2,4-13C2)butanoate |
| InChIKey | XYIBRDXRRQCHLP-NDLBAUGKSA-N |
| SMILES | CCOC(=O)[13CH2]C(=O)[13CH3] |
Computed by PubChem (NCBI)