Products 77518-07-1
CAS 77518-07-1 is the registry number for Amiflamine. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(2S)-2-aminopropyl]-N,N,3-trimethylaniline (CAS 77518-07-1) is a chemical compound with the molecular formula C12H20N2 and a molecular weight of 192.30 g/mol. IUPAC name: 4-[(2S)-2-aminopropyl]-N,N,3-trimethylaniline. InChIKey: HFQMYSHATTXRTC-JTQLQIEISA-N.
| Molecular formula | C12H20N2 |
|---|---|
| Molecular weight | 192.30 g/mol |
| IUPAC name | 4-[(2S)-2-aminopropyl]-N,N,3-trimethylaniline |
| InChIKey | HFQMYSHATTXRTC-JTQLQIEISA-N |
| SMILES | CC1=C(C=CC(=C1)N(C)C)C[C@H](C)N |
Computed by PubChem (NCBI)