CAS 775223-82-0 is the registry number for Methyl (2R,5R)–5–methylpyrrolidine–2–carboxylate. Offered by: GLPBio. Available pack sizes: 1g.
Methyl (2R,5R)-5-methylpyrrolidine-2-carboxylate (CAS 775223-82-0) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: methyl (2R,5R)-5-methylpyrrolidine-2-carboxylate. InChIKey: FZBQCOBVXDOWIT-PHDIDXHHSA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | methyl (2R,5R)-5-methylpyrrolidine-2-carboxylate |
| InChIKey | FZBQCOBVXDOWIT-PHDIDXHHSA-N |
| SMILES | C[C@@H]1CC[C@@H](N1)C(=O)OC |
Computed by PubChem (NCBI)