CAS 77530-02-0 is the registry number for beta-(Z)-Brivudine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
5-[(Z)-2-bromoethenyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 77530-02-0) is a chemical compound with the molecular formula C11H13BrN2O5 and a molecular weight of 333.13 g/mol. IUPAC name: 5-[(Z)-2-bromoethenyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: ODZBBRURCPAEIQ-IWMFZOCNSA-N.
| Molecular formula | C11H13BrN2O5 |
|---|---|
| Molecular weight | 333.13 g/mol |
| IUPAC name | 5-[(Z)-2-bromoethenyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | ODZBBRURCPAEIQ-IWMFZOCNSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=C(C(=O)NC2=O)/C=C\Br)CO)O |
Computed by PubChem (NCBI)