CAS 775542-05-7 is the registry number for Dopexamine Dihydrochloride-d3. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3,4,6-trideuterio-5-[2-[6-(2-phenylethylamino)hexylamino]ethyl]benzene-1,2-diol (CAS 775542-05-7) is a chemical compound with the molecular formula C22H32N2O2 and a molecular weight of 359.5 g/mol. IUPAC name: 3,4,6-trideuterio-5-[2-[6-(2-phenylethylamino)hexylamino]ethyl]benzene-1,2-diol. InChIKey: RYBJORHCUPVNMB-CHYKZQLPSA-N.
| Molecular formula | C22H32N2O2 |
|---|---|
| Molecular weight | 359.5 g/mol |
| IUPAC name | 3,4,6-trideuterio-5-[2-[6-(2-phenylethylamino)hexylamino]ethyl]benzene-1,2-diol |
| InChIKey | RYBJORHCUPVNMB-CHYKZQLPSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CCNCCCCCCNCCC2=CC=CC=C2)[2H])O)O)[2H] |
Computed by PubChem (NCBI)