CAS 7758-23-8 appears in our catalog under these names: Calcium dihydrogen phosphate hydrate/ 90+%, Calcium phosphate, monobasic, 90%, pure, wapnia diwodorofosforan 1hydrat cz, wapnia diwodorofosforan 1hydrat czda, wapnia diwodorofosforan bezw cz. Offered by: Chemat, Thermo Scientific (Acros), Chempur, Ambeed. Available pack sizes: 2kg, 5kg, 1KG, 10g, 25g, 50g, 100g, 250g.
Calcium bis(dihydrogen phosphate) (CAS 7758-23-8) is a chemical compound with the molecular formula CaH4O8P2 and a molecular weight of 234.05 g/mol. IUPAC name: calcium bis(dihydrogen phosphate). InChIKey: YYRMJZQKEFZXMX-UHFFFAOYSA-L.
| Molecular formula | CaH4O8P2 |
|---|---|
| Molecular weight | 234.05 g/mol |
| IUPAC name | calcium bis(dihydrogen phosphate) |
| InChIKey | YYRMJZQKEFZXMX-UHFFFAOYSA-L |
| SMILES | OP(=O)(O)[O-].OP(=O)(O)[O-].[Ca+2] |
Computed by PubChem (NCBI)