CAS 77607-09-1 appears in our catalog under these names: 2,3,4,5,3',4'-Hexabromobiphenyl, PBB No. 156. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 5mg.
1,2,3,4-tetrabromo-5-(3,4-dibromophenyl)benzene (CAS 77607-09-1) is a chemical compound with the molecular formula C12H4Br6 and a molecular weight of 627.6 g/mol. IUPAC name: 1,2,3,4-tetrabromo-5-(3,4-dibromophenyl)benzene. InChIKey: LSUMPCYLOQMSTJ-UHFFFAOYSA-N.
| Molecular formula | C12H4Br6 |
|---|---|
| Molecular weight | 627.6 g/mol |
| IUPAC name | 1,2,3,4-tetrabromo-5-(3,4-dibromophenyl)benzene |
| InChIKey | LSUMPCYLOQMSTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C(=C2Br)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)