Products 77607-70-6
CAS 77607-70-6 is the registry number for MK2-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-6-(4-chlorophenyl)-4-(furan-2-yl)pyridine-3-carbonitrile (CAS 77607-70-6) is a chemical compound with the molecular formula C16H10ClN3O and a molecular weight of 295.72 g/mol. IUPAC name: 2-amino-6-(4-chlorophenyl)-4-(furan-2-yl)pyridine-3-carbonitrile. InChIKey: LCAAKPMYGBRCEX-UHFFFAOYSA-N.
| Molecular formula | C16H10ClN3O |
|---|---|
| Molecular weight | 295.72 g/mol |
| IUPAC name | 2-amino-6-(4-chlorophenyl)-4-(furan-2-yl)pyridine-3-carbonitrile |
| InChIKey | LCAAKPMYGBRCEX-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC(=NC(=C2C#N)N)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)