CAS 77629-31-3 is the registry number for (S)-5-Methylnicotine. Offered by: TRC. Available pack sizes: 100mg.
3-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine (CAS 77629-31-3) is a chemical compound with the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. IUPAC name: 3-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine. InChIKey: WPPLPODBERCBRQ-NSHDSACASA-N.
| Molecular formula | C11H16N2 |
|---|---|
| Molecular weight | 176.26 g/mol |
| IUPAC name | 3-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| InChIKey | WPPLPODBERCBRQ-NSHDSACASA-N |
| SMILES | CC1=CC(=CN=C1)[C@@H]2CCCN2C |
Computed by PubChem (NCBI)