CAS 77668-56-5 is the registry number for 5-Chloro Lamotrigine. Offered by: TRC. Available pack sizes: 250mg.
6-(2,3,5-trichlorophenyl)-1,2,4-triazine-3,5-diamine (CAS 77668-56-5) is a chemical compound with the molecular formula C9H6Cl3N5 and a molecular weight of 290.5 g/mol. IUPAC name: 6-(2,3,5-trichlorophenyl)-1,2,4-triazine-3,5-diamine. InChIKey: KWYJAWJSLDHFCF-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl3N5 |
|---|---|
| Molecular weight | 290.5 g/mol |
| IUPAC name | 6-(2,3,5-trichlorophenyl)-1,2,4-triazine-3,5-diamine |
| InChIKey | KWYJAWJSLDHFCF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C2=C(N=C(N=N2)N)N)Cl)Cl)Cl |
Computed by PubChem (NCBI)