CAS 77668-57-6 appears in our catalog under these names: Lamotrigine N-Acetate, >95% (HPLC), Lamotrigine N-acetate. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 50mg, 100mg.
N-[3-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-5-yl]acetamide (CAS 77668-57-6) is a chemical compound with the molecular formula C11H9Cl2N5O and a molecular weight of 298.13 g/mol. IUPAC name: N-[3-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-5-yl]acetamide. InChIKey: NDSIXLUNGJHLOJ-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2N5O |
|---|---|
| Molecular weight | 298.13 g/mol |
| IUPAC name | N-[3-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-5-yl]acetamide |
| InChIKey | NDSIXLUNGJHLOJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(N=NC(=N1)N)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)